C11H11ClN4O — CID 1477643
N-(4-chloro-2-methylphenyl)-2-(1,2,4-triazol-1-yl)acetamide (PubChem CID 1477643) has the molecular formula C11H11ClN4O and a molecular weight of 250.69 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2-(1,2,4-triazol-1-yl)acetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2-(1,2,4-triazol-1-yl)acetamide |
|---|---|
| PubChem CID | 1477643 |
| Molecular Formula | C11H11ClN4O |
| Molecular Weight | 250.69 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2-(1,2,4-triazol-1-yl)acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)Cn1cncn1 |
| InChI | InChI=1S/C11H11ClN4O/c1-8-4-9(12)2-3-10(8)15-11(17)5-16-7-13-6-14-16/h2-4,6-7H,5H2,1H3,(H,15,17) |
| InChIKey | QKYFNQSTZQKZAR-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.69 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |