C16H13ClN4O — CID 2988626
N-(2-chloro-4-methylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide (PubChem CID 2988626) has the molecular formula C16H13ClN4O and a molecular weight of 312.76 g/mol. Its IUPAC name is N-(2-chloro-4-methylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide.
| Compound Name | N-(2-chloro-4-methylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 2988626 |
| Molecular Formula | C16H13ClN4O |
| Molecular Weight | 312.76 g/mol |
| Exact Mass | 312.08 |
| IUPAC Name | N-(2-chloro-4-methylphenyl)-1-phenyl-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ncn(-c3ccccc3)n2)c(Cl)c1 |
| InChI | InChI=1S/C16H13ClN4O/c1-11-7-8-14(13(17)9-11)19-16(22)15-18-10-21(20-15)12-5-3-2-4-6-12/h2-10H,1H3,(H,19,22) |
| InChIKey | DMCYHHBXTCBDAB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.76 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |