C8H14N2O — CID 147769981
N-(3-iminoprop-1-en-2-yl)-2,2-dimethylpropanamide (PubChem CID 147769981) has the molecular formula C8H14N2O and a molecular weight of 154.21 g/mol. Its IUPAC name is N-(3-iminoprop-1-en-2-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(3-iminoprop-1-en-2-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 147769981 |
| Molecular Formula | C8H14N2O |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.11 |
| IUPAC Name | N-(3-iminoprop-1-en-2-yl)-2,2-dimethylpropanamide |
| SMILES | [H]/N=C/C(=C)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C8H14N2O/c1-6(5-9)10-7(11)8(2,3)4/h5,9H,1H2,2-4H3,(H,10,11)/b9-5+ |
| InChIKey | HFSUMRAGSGDTGO-WEVVVXLNSA-N |
| XLogP | 1.31 |
| TPSA | 52.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|