C10H20N2O — CID 170752207
N-[(E)-1-ethyliminobut-2-en-2-yl]-2-methylpropanamide;molecular hydrogen (PubChem CID 170752207) has the molecular formula C10H20N2O and a molecular weight of 184.28 g/mol. Its IUPAC name is N-[(E)-1-ethyliminobut-2-en-2-yl]-2-methylpropanamide;molecular hydrogen.
| Compound Name | N-[(E)-1-ethyliminobut-2-en-2-yl]-2-methylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 170752207 |
| Molecular Formula | C10H20N2O |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | N-[(E)-1-ethyliminobut-2-en-2-yl]-2-methylpropanamide;molecular hydrogen |
| SMILES | C/C=C(\C=N\CC)NC(=O)C(C)C.[H][H] |
| InChI | InChI=1S/C10H18N2O.H2/c1-5-9(7-11-6-2)12-10(13)8(3)4;/h5,7-8H,6H2,1-4H3,(H,12,13);1H/b9-5+,11-7+; |
| InChIKey | ONNMPXVMNBRZQI-JHYBDDPSSA-N |
| XLogP | 2.00 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|