C11H18N2O — CID 143328611
ethane;N-[(E)-1-prop-2-ynyliminobut-2-en-2-yl]acetamide (PubChem CID 143328611) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;N-[(E)-1-prop-2-ynyliminobut-2-en-2-yl]acetamide.
| Compound Name | ethane;N-[(E)-1-prop-2-ynyliminobut-2-en-2-yl]acetamide |
|---|---|
| PubChem CID | 143328611 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;N-[(E)-1-prop-2-ynyliminobut-2-en-2-yl]acetamide |
| SMILES | C#CC/N=C/C(=C\C)NC(C)=O.CC |
| InChI | InChI=1S/C9H12N2O.C2H6/c1-4-6-10-7-9(5-2)11-8(3)12;1-2/h1,5,7H,6H2,2-3H3,(H,11,12);1-2H3/b9-5+,10-7+; |
| InChIKey | CEBHZYBYWJRLOG-QYVYXNNQSA-N |
| XLogP | 1.76 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|