C11H16N2O — CID 143610218
N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]acetamide;prop-1-yne (PubChem CID 143610218) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]acetamide;prop-1-yne.
| Compound Name | N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]acetamide;prop-1-yne |
|---|---|
| PubChem CID | 143610218 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | N-[(3E)-5-methyliminopenta-1,3-dien-3-yl]acetamide;prop-1-yne |
| SMILES | C#CC.C=C/C(=C\C=N\C)NC(C)=O |
| InChI | InChI=1S/C8H12N2O.C3H4/c1-4-8(5-6-9-3)10-7(2)11;1-3-2/h4-6H,1H2,2-3H3,(H,10,11);1H,2H3/b8-5+,9-6+; |
| InChIKey | ONSSVCOYVCPBKN-OYPDEJHISA-N |
| XLogP | 1.53 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|