C11H16N2O — CID 142957645
ethane;(5E,6E)-6-ethylidene-5-prop-2-enylidenepyrazin-2-one (PubChem CID 142957645) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is ethane;(5E,6E)-6-ethylidene-5-prop-2-enylidenepyrazin-2-one.
| Compound Name | ethane;(5E,6E)-6-ethylidene-5-prop-2-enylidenepyrazin-2-one |
|---|---|
| PubChem CID | 142957645 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | ethane;(5E,6E)-6-ethylidene-5-prop-2-enylidenepyrazin-2-one |
| SMILES | C=C/C=c1/ncc(=O)[nH]/c1=C/C.CC |
| InChI | InChI=1S/C9H10N2O.C2H6/c1-3-5-8-7(4-2)11-9(12)6-10-8;1-2/h3-6H,1H2,2H3,(H,11,12);1-2H3/b7-4+,8-5+; |
| InChIKey | WFDARXJAZBRQNQ-JJHSXXHRSA-N |
| XLogP | 0.56 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |