C9H14N2O — CID 143106770
N-[(1Z,3E)-1-(ethylideneamino)penta-1,3-dien-3-yl]acetamide (PubChem CID 143106770) has the molecular formula C9H14N2O and a molecular weight of 166.22 g/mol. Its IUPAC name is N-[(1Z,3E)-1-(ethylideneamino)penta-1,3-dien-3-yl]acetamide.
| Compound Name | N-[(1Z,3E)-1-(ethylideneamino)penta-1,3-dien-3-yl]acetamide |
|---|---|
| PubChem CID | 143106770 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | N-[(1Z,3E)-1-(ethylideneamino)penta-1,3-dien-3-yl]acetamide |
| SMILES | C/C=N/C=C\C(=C/C)NC(C)=O |
| InChI | InChI=1S/C9H14N2O/c1-4-9(11-8(3)12)6-7-10-5-2/h4-7H,1-3H3,(H,11,12)/b7-6-,9-4+,10-5+ |
| InChIKey | SDTYSEQYHHISNS-OYRNZXRRSA-N |
| XLogP | 1.63 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|