C9H12N2O — CID 143328612
N-[(E)-1-prop-2-ynyliminobut-2-en-2-yl]acetamide (PubChem CID 143328612) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is N-[(E)-1-prop-2-ynyliminobut-2-en-2-yl]acetamide.
| Compound Name | N-[(E)-1-prop-2-ynyliminobut-2-en-2-yl]acetamide |
|---|---|
| PubChem CID | 143328612 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-[(E)-1-prop-2-ynyliminobut-2-en-2-yl]acetamide |
| SMILES | C#CC/N=C/C(=C\C)NC(C)=O |
| InChI | InChI=1S/C9H12N2O/c1-4-6-10-7-9(5-2)11-8(3)12/h1,5,7H,6H2,2-3H3,(H,11,12)/b9-5+,10-7+ |
| InChIKey | BAAJUWUSNLUUJC-FWMCCXIMSA-N |
| XLogP | 0.73 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|