C10H22N2O — CID 170752129
ethane;N-[(E)-1-ethyliminobut-2-en-2-yl]acetamide;molecular hydrogen (PubChem CID 170752129) has the molecular formula C10H22N2O and a molecular weight of 186.30 g/mol. Its IUPAC name is ethane;N-[(E)-1-ethyliminobut-2-en-2-yl]acetamide;molecular hydrogen.
| Compound Name | ethane;N-[(E)-1-ethyliminobut-2-en-2-yl]acetamide;molecular hydrogen |
|---|---|
| PubChem CID | 170752129 |
| Molecular Formula | C10H22N2O |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.17 |
| IUPAC Name | ethane;N-[(E)-1-ethyliminobut-2-en-2-yl]acetamide;molecular hydrogen |
| SMILES | C/C=C(\C=N\CC)NC(C)=O.CC.[H][H] |
| InChI | InChI=1S/C8H14N2O.C2H6.H2/c1-4-8(6-9-5-2)10-7(3)11;1-2;/h4,6H,5H2,1-3H3,(H,10,11);1-2H3;1H/b8-4+,9-6+;; |
| InChIKey | JPKLVTKIJOOYCH-ZEZGLLRXSA-N |
| XLogP | 2.39 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|