C24H22Cl2N6O3 — CID 147771248
4-[(2,6-dichlorobenzoyl)amino]-N-[(3R)-1-[3-(prop-2-enoylamino)phenyl]pyrrolidin-3-yl]-1H-pyrazole-5-carboxamide (PubChem CID 147771248) has the molecular formula C24H22Cl2N6O3 and a molecular weight of 513.39 g/mol. Its IUPAC name is 4-[(2,6-dichlorobenzoyl)amino]-N-[(3R)-1-[3-(prop-2-enoylamino)phenyl]pyrrolidin-3-yl]-1H-pyrazole-5-carboxamide.
| Compound Name | 4-[(2,6-dichlorobenzoyl)amino]-N-[(3R)-1-[3-(prop-2-enoylamino)phenyl]pyrrolidin-3-yl]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 147771248 |
| Molecular Formula | C24H22Cl2N6O3 |
| Molecular Weight | 513.39 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | 4-[(2,6-dichlorobenzoyl)amino]-N-[(3R)-1-[3-(prop-2-enoylamino)phenyl]pyrrolidin-3-yl]-1H-pyrazole-5-carboxamide |
| SMILES | C=CC(=O)Nc1cccc(N2CC[C@@H](NC(=O)c3[nH]ncc3NC(=O)c3c(Cl)cccc3Cl)C2)c1 |
| InChI | InChI=1S/C24H22Cl2N6O3/c1-2-20(33)28-14-5-3-6-16(11-14)32-10-9-15(13-32)29-24(35)22-19(12-27-31-22)30-23(34)21-17(25)7-4-8-18(21)26/h2-8,11-12,15H,1,9-10,13H2,(H,27,31)(H,28,33)(H,29,35)(H,30,34)/t15-/m1/s1 |
| InChIKey | HFYWDOVDDXDXDP-OAHLLOKOSA-N |
| XLogP | 4.10 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.39 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|