C25H24Cl2N6O3 — CID 155538471
N-[(3S)-1-[3-[[(E)-but-2-enoyl]amino]phenyl]pyrrolidin-3-yl]-4-[(2,6-dichlorobenzoyl)amino]-1H-pyrazole-5-carboxamide (PubChem CID 155538471) has the molecular formula C25H24Cl2N6O3 and a molecular weight of 527.41 g/mol. Its IUPAC name is N-[(3S)-1-[3-[[(E)-but-2-enoyl]amino]phenyl]pyrrolidin-3-yl]-4-[(2,6-dichlorobenzoyl)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | N-[(3S)-1-[3-[[(E)-but-2-enoyl]amino]phenyl]pyrrolidin-3-yl]-4-[(2,6-dichlorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 155538471 |
| Molecular Formula | C25H24Cl2N6O3 |
| Molecular Weight | 527.41 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | N-[(3S)-1-[3-[[(E)-but-2-enoyl]amino]phenyl]pyrrolidin-3-yl]-4-[(2,6-dichlorobenzoyl)amino]-1H-pyrazole-5-carboxamide |
| SMILES | C/C=C/C(=O)Nc1cccc(N2CC[C@H](NC(=O)c3[nH]ncc3NC(=O)c3c(Cl)cccc3Cl)C2)c1 |
| InChI | InChI=1S/C25H24Cl2N6O3/c1-2-5-21(34)29-15-6-3-7-17(12-15)33-11-10-16(14-33)30-25(36)23-20(13-28-32-23)31-24(35)22-18(26)8-4-9-19(22)27/h2-9,12-13,16H,10-11,14H2,1H3,(H,28,32)(H,29,34)(H,30,36)(H,31,35)/b5-2+/t16-/m0/s1 |
| InChIKey | MQNVEFBHNZGVSD-AUYOJAJCSA-N |
| XLogP | 4.49 |
| TPSA | 119.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.41 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|