C27H38N4O4 — CID 147781804
1-[4-[[2-[[4-methoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]methyl]pyrimidin-4-yl]oxymethyl]piperidin-1-yl]ethanone (PubChem CID 147781804) has the molecular formula C27H38N4O4 and a molecular weight of 482.63 g/mol. Its IUPAC name is 1-[4-[[2-[[4-methoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]methyl]pyrimidin-4-yl]oxymethyl]piperidin-1-yl]ethanone.
| Compound Name | 1-[4-[[2-[[4-methoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]methyl]pyrimidin-4-yl]oxymethyl]piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 147781804 |
| Molecular Formula | C27H38N4O4 |
| Molecular Weight | 482.63 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | 1-[4-[[2-[[4-methoxy-3-(3-pyrrolidin-1-ylpropoxy)phenyl]methyl]pyrimidin-4-yl]oxymethyl]piperidin-1-yl]ethanone |
| SMILES | COc1ccc(Cc2nccc(OCC3CCN(C(C)=O)CC3)n2)cc1OCCCN1CCCC1 |
| InChI | InChI=1S/C27H38N4O4/c1-21(32)31-15-9-22(10-16-31)20-35-27-8-11-28-26(29-27)19-23-6-7-24(33-2)25(18-23)34-17-5-14-30-12-3-4-13-30/h6-8,11,18,22H,3-5,9-10,12-17,19-20H2,1-2H3 |
| InChIKey | HHXYAUBBCYMVNP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 77.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.63 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|