C22H24BrN5O2+2 — CID 147783468
5-bromo-3-[3-(2-piperazine-1,4-diium-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol (PubChem CID 147783468) has the molecular formula C22H24BrN5O2+2 and a molecular weight of 470.37 g/mol. Its IUPAC name is 5-bromo-3-[3-(2-piperazine-1,4-diium-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol.
| Compound Name | 5-bromo-3-[3-(2-piperazine-1,4-diium-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol |
|---|---|
| PubChem CID | 147783468 |
| Molecular Formula | C22H24BrN5O2+2 |
| Molecular Weight | 470.37 g/mol |
| Exact Mass | 469.11 |
| IUPAC Name | 5-bromo-3-[3-(2-piperazine-1,4-diium-1-ylethoxyimino)indol-2-yl]-1H-indol-2-ol |
| SMILES | Oc1[nH]c2ccc(Br)cc2c1C1=Nc2ccccc2C1=NOCC[NH+]1CC[NH2+]CC1 |
| InChI | InChI=1S/C22H22BrN5O2/c23-14-5-6-18-16(13-14)19(22(29)26-18)21-20(15-3-1-2-4-17(15)25-21)27-30-12-11-28-9-7-24-8-10-28/h1-6,13,24,26,29H,7-12H2/p+2 |
| InChIKey | DPDVEOGWPLEOAN-UHFFFAOYSA-P |
| XLogP | 0.95 |
| TPSA | 91.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.37 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_imine_A(9)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|