C21H24N4O2S2 — CID 147795831
4-[(3aS,7aR)-1-(benzenesulfonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-ethylthieno[2,3-d]pyrimidine (PubChem CID 147795831) has the molecular formula C21H24N4O2S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is 4-[(3aS,7aR)-1-(benzenesulfonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-ethylthieno[2,3-d]pyrimidine.
| Compound Name | 4-[(3aS,7aR)-1-(benzenesulfonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-ethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 147795831 |
| Molecular Formula | C21H24N4O2S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-[(3aS,7aR)-1-(benzenesulfonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-ethylthieno[2,3-d]pyrimidine |
| SMILES | CCc1cc2c(N3CC[C@@H]4[C@@H](CCN4S(=O)(=O)c4ccccc4)C3)ncnc2s1 |
| InChI | InChI=1S/C21H24N4O2S2/c1-2-16-12-18-20(22-14-23-21(18)28-16)24-10-9-19-15(13-24)8-11-25(19)29(26,27)17-6-4-3-5-7-17/h3-7,12,14-15,19H,2,8-11,13H2,1H3/t15-,19+/m0/s1 |
| InChIKey | HKNUEHGZPMIXLB-HNAYVOBHSA-N |
| XLogP | 3.54 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |