C21H21F3N4O2S2 — CID 134364787
4-[(3aR,7aS)-1-(benzenesulfonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134364787) has the molecular formula C21H21F3N4O2S2 and a molecular weight of 482.55 g/mol. Its IUPAC name is 4-[(3aR,7aS)-1-(benzenesulfonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[(3aR,7aS)-1-(benzenesulfonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134364787 |
| Molecular Formula | C21H21F3N4O2S2 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | 4-[(3aR,7aS)-1-(benzenesulfonyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridin-5-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | O=S(=O)(c1ccccc1)N1CC[C@@H]2CN(c3ncnc4sc(CC(F)(F)F)cc34)CC[C@@H]21 |
| InChI | InChI=1S/C21H21F3N4O2S2/c22-21(23,24)11-15-10-17-19(25-13-26-20(17)31-15)27-8-7-18-14(12-27)6-9-28(18)32(29,30)16-4-2-1-3-5-16/h1-5,10,13-14,18H,6-9,11-12H2/t14-,18+/m1/s1 |
| InChIKey | ZIJVJZCADRCEGY-KDOFPFPSSA-N |
| XLogP | 4.09 |
| TPSA | 66.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |