C20H21F3N6S — CID 134364727
4-[(3aS,7aS)-5-(pyrimidin-5-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134364727) has the molecular formula C20H21F3N6S and a molecular weight of 434.49 g/mol. Its IUPAC name is 4-[(3aS,7aS)-5-(pyrimidin-5-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[(3aS,7aS)-5-(pyrimidin-5-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134364727 |
| Molecular Formula | C20H21F3N6S |
| Molecular Weight | 434.49 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 4-[(3aS,7aS)-5-(pyrimidin-5-ylmethyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | FC(F)(F)Cc1cc2c(N3C[C@H]4CCN(Cc5cncnc5)C[C@H]4C3)ncnc2s1 |
| InChI | InChI=1S/C20H21F3N6S/c21-20(22,23)4-16-3-17-18(26-12-27-19(17)30-16)29-9-14-1-2-28(8-15(14)10-29)7-13-5-24-11-25-6-13/h3,5-6,11-12,14-15H,1-2,4,7-10H2/t14-,15+/m1/s1 |
| InChIKey | DAFMHIPWEGVZNN-CABCVRRESA-N |
| XLogP | 3.54 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.49 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |