C19H25F3N4S — CID 134364816
4-[5-(2-methylpropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134364816) has the molecular formula C19H25F3N4S and a molecular weight of 398.50 g/mol. Its IUPAC name is 4-[5-(2-methylpropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[5-(2-methylpropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134364816 |
| Molecular Formula | C19H25F3N4S |
| Molecular Weight | 398.50 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 4-[5-(2-methylpropyl)-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | CC(C)CN1CCC2CN(c3ncnc4sc(CC(F)(F)F)cc34)CC2C1 |
| InChI | InChI=1S/C19H25F3N4S/c1-12(2)7-25-4-3-13-9-26(10-14(13)8-25)17-16-5-15(6-19(20,21)22)27-18(16)24-11-23-17/h5,11-14H,3-4,6-10H2,1-2H3 |
| InChIKey | SKZPIHSKOWVTGH-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.50 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |