C16H18F3N3S — CID 158489153
4-[(4aR,7aR)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 158489153) has the molecular formula C16H18F3N3S and a molecular weight of 341.40 g/mol. Its IUPAC name is 4-[(4aR,7aR)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[(4aR,7aR)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 158489153 |
| Molecular Formula | C16H18F3N3S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.12 |
| IUPAC Name | 4-[(4aR,7aR)-1,3,4,4a,5,6,7,7a-octahydrocyclopenta[c]pyridin-2-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | FC(F)(F)Cc1cc2c(N3CC[C@H]4CCC[C@H]4C3)ncnc2s1 |
| InChI | InChI=1S/C16H18F3N3S/c17-16(18,19)7-12-6-13-14(20-9-21-15(13)23-12)22-5-4-10-2-1-3-11(10)8-22/h6,9-11H,1-5,7-8H2/t10-,11+/m1/s1 |
| InChIKey | HIMCOLABFPFPAM-MNOVXSKESA-N |
| XLogP | 4.42 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |