C20H24F3N5OS — CID 134364815
[(3aR,7aS)-2-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-pyrrolidin-2-ylmethanone (PubChem CID 134364815) has the molecular formula C20H24F3N5OS and a molecular weight of 439.51 g/mol. Its IUPAC name is [(3aR,7aS)-2-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-pyrrolidin-2-ylmethanone.
| Compound Name | [(3aR,7aS)-2-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-pyrrolidin-2-ylmethanone |
|---|---|
| PubChem CID | 134364815 |
| Molecular Formula | C20H24F3N5OS |
| Molecular Weight | 439.51 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | [(3aR,7aS)-2-[6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidin-4-yl]-3,3a,4,6,7,7a-hexahydro-1H-pyrrolo[3,4-c]pyridin-5-yl]-pyrrolidin-2-ylmethanone |
| SMILES | O=C(C1CCCN1)N1CC[C@@H]2CN(c3ncnc4sc(CC(F)(F)F)cc34)C[C@@H]2C1 |
| InChI | InChI=1S/C20H24F3N5OS/c21-20(22,23)7-14-6-15-17(25-11-26-18(15)30-14)28-8-12-3-5-27(9-13(12)10-28)19(29)16-2-1-4-24-16/h6,11-13,16,24H,1-5,7-10H2/t12-,13+,16?/m1/s1 |
| InChIKey | XFNFOUXDABCRGR-IMSGDLLMSA-N |
| XLogP | 2.83 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.51 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |