C15H17F3N4S — CID 134364736
4-[(3aS,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine (PubChem CID 134364736) has the molecular formula C15H17F3N4S and a molecular weight of 342.39 g/mol. Its IUPAC name is 4-[(3aS,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine.
| Compound Name | 4-[(3aS,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 134364736 |
| Molecular Formula | C15H17F3N4S |
| Molecular Weight | 342.39 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | 4-[(3aS,7aR)-1,2,3,3a,4,6,7,7a-octahydropyrrolo[3,2-c]pyridin-5-yl]-6-(2,2,2-trifluoroethyl)thieno[2,3-d]pyrimidine |
| SMILES | FC(F)(F)Cc1cc2c(N3CC[C@H]4NCC[C@H]4C3)ncnc2s1 |
| InChI | InChI=1S/C15H17F3N4S/c16-15(17,18)6-10-5-11-13(20-8-21-14(11)23-10)22-4-2-12-9(7-22)1-3-19-12/h5,8-9,12,19H,1-4,6-7H2/t9-,12+/m0/s1 |
| InChIKey | YTCZHHOHLTTWJY-JOYOIKCWSA-N |
| XLogP | 2.98 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.39 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |