About 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone
1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone (PubChem CID 14781075) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone.
Molecular Properties
| Compound Name | 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone |
| PubChem CID | 14781075 |
| Molecular Formula | C11H16O3 |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.11 |
| IUPAC Name | 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone |
| SMILES | CC(=O)C1CC2CC1CC21OCCO1 |
| InChI | InChI=1S/C11H16O3/c1-7(12)10-5-9-4-8(10)6-11(9)13-2-3-14-11/h8-10H,2-6H2,1H3 |
| InChIKey | IGKKYTSWZWYPOV-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone?
The IUPAC name of 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone (CID 14781075) is 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone.
What is the SMILES notation for 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone?
The canonical SMILES for 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone is CC(=O)C1CC2CC1CC21OCCO1.
What is the InChIKey of 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone?
The InChIKey is IGKKYTSWZWYPOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O3/c1-7(12)10-5-9-4-8(10)6-11(9)13-2-3-14-11/h8-10H,2-6H2,1H3.
What are the key properties of 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone?
1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone has a molecular weight of 196.25 g/mol, XLogP of 1.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-spiro[1,3-dioxolane-2,5'-bicyclo[2.2.1]heptane]-2'-ylethanone is sourced from PubChem (CID 14781075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).