C31H35Cl2N7O4S — CID 147812768
N-[(1R,2S)-4-cyclobutyl-2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-(1,3-thiazol-2-ylmethyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 147812768) has the molecular formula C31H35Cl2N7O4S and a molecular weight of 672.64 g/mol. Its IUPAC name is N-[(1R,2S)-4-cyclobutyl-2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-(1,3-thiazol-2-ylmethyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[(1R,2S)-4-cyclobutyl-2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-(1,3-thiazol-2-ylmethyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 147812768 |
| Molecular Formula | C31H35Cl2N7O4S |
| Molecular Weight | 672.64 g/mol |
| Exact Mass | 671.18 |
| IUPAC Name | N-[(1R,2S)-4-cyclobutyl-2-[[3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-1-(1,3-thiazol-2-ylmethyl)-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)N[C@@H]1CCC(C2CCC2)C[C@@H]1Nc1ncc2c(n1)N(Cc1nccs1)C(=O)N(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C31H35Cl2N7O4S/c1-4-24(41)36-20-9-8-18(17-6-5-7-17)12-21(20)37-30-35-14-19-15-39(28-26(32)22(43-2)13-23(44-3)27(28)33)31(42)40(29(19)38-30)16-25-34-10-11-45-25/h4,10-11,13-14,17-18,20-21H,1,5-9,12,15-16H2,2-3H3,(H,36,41)(H,35,37,38)/t18?,20-,21+/m1/s1 |
| InChIKey | KKIXPKPXRVRIOO-HBYOEVMUSA-N |
| XLogP | 6.46 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.64 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|