C25H27Cl2N7O4 — CID 90436762
N-[2-[[1-(cyanomethyl)-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide (PubChem CID 90436762) has the molecular formula C25H27Cl2N7O4 and a molecular weight of 560.44 g/mol. Its IUPAC name is N-[2-[[1-(cyanomethyl)-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide.
| Compound Name | N-[2-[[1-(cyanomethyl)-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide |
|---|---|
| PubChem CID | 90436762 |
| Molecular Formula | C25H27Cl2N7O4 |
| Molecular Weight | 560.44 g/mol |
| Exact Mass | 559.15 |
| IUPAC Name | N-[2-[[1-(cyanomethyl)-3-(2,6-dichloro-3,5-dimethoxyphenyl)-2-oxo-4H-pyrimido[4,5-d]pyrimidin-7-yl]amino]cyclohexyl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CCCCC1Nc1ncc2c(n1)N(CC#N)C(=O)N(c1c(Cl)c(OC)cc(OC)c1Cl)C2 |
| InChI | InChI=1S/C25H27Cl2N7O4/c1-4-19(35)30-15-7-5-6-8-16(15)31-24-29-12-14-13-34(25(36)33(10-9-28)23(14)32-24)22-20(26)17(37-2)11-18(38-3)21(22)27/h4,11-12,15-16H,1,5-8,10,13H2,2-3H3,(H,30,35)(H,29,31,32) |
| InChIKey | LPPJSIKMMPVTHV-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 132.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.44 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|