C15H24O2 — CID 14782830
methyl (2E,3aS,7aR)-2-butylidene-3,4,5,6,7,7a-hexahydro-1H-indene-3a-carboxylate (PubChem CID 14782830) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is methyl (2E,3aS,7aR)-2-butylidene-3,4,5,6,7,7a-hexahydro-1H-indene-3a-carboxylate.
| Compound Name | methyl (2E,3aS,7aR)-2-butylidene-3,4,5,6,7,7a-hexahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 14782830 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | methyl (2E,3aS,7aR)-2-butylidene-3,4,5,6,7,7a-hexahydro-1H-indene-3a-carboxylate |
| SMILES | CCC/C=C1\C[C@H]2CCCC[C@]2(C(=O)OC)C1 |
| InChI | InChI=1S/C15H24O2/c1-3-4-7-12-10-13-8-5-6-9-15(13,11-12)14(16)17-2/h7,13H,3-6,8-11H2,1-2H3/b12-7+/t13-,15+/m1/s1 |
| InChIKey | NOCFRYLVYOWIAL-HERRNLAMSA-N |
| XLogP | 3.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|