C67H49N5O3 — CID 147828579
1-N,3-N-bis(4-benzo[f]quinolin-3-ylphenyl)-5-[2-(4-benzo[f]quinolin-3-ylphenyl)acetyl]cyclohexane-1,3-dicarboxamide (PubChem CID 147828579) has the molecular formula C67H49N5O3 and a molecular weight of 972.16 g/mol. Its IUPAC name is 1-N,3-N-bis(4-benzo[f]quinolin-3-ylphenyl)-5-[2-(4-benzo[f]quinolin-3-ylphenyl)acetyl]cyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis(4-benzo[f]quinolin-3-ylphenyl)-5-[2-(4-benzo[f]quinolin-3-ylphenyl)acetyl]cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 147828579 |
| Molecular Formula | C67H49N5O3 |
| Molecular Weight | 972.16 g/mol |
| Exact Mass | 971.38 |
| IUPAC Name | 1-N,3-N-bis(4-benzo[f]quinolin-3-ylphenyl)-5-[2-(4-benzo[f]quinolin-3-ylphenyl)acetyl]cyclohexane-1,3-dicarboxamide |
| SMILES | O=C(Cc1ccc(-c2ccc3c(ccc4ccccc43)n2)cc1)C1CC(C(=O)Nc2ccc(-c3ccc4c(ccc5ccccc54)n3)cc2)CC(C(=O)Nc2ccc(-c3ccc4c(ccc5ccccc54)n3)cc2)C1 |
| InChI | InChI=1S/C67H49N5O3/c73-65(37-41-13-15-45(16-14-41)59-34-28-56-53-10-4-1-7-42(53)21-31-62(56)70-59)48-38-49(66(74)68-51-24-17-46(18-25-51)60-35-29-57-54-11-5-2-8-43(54)22-32-63(57)71-60)40-50(39-48)67(75)69-52-26-19-47(20-27-52)61-36-30-58-55-12-6-3-9-44(55)23-33-64(58)72-61/h1-36,48-50H,37-40H2,(H,68,74)(H,69,75) |
| InChIKey | HQQIOHIPIMRSCP-UHFFFAOYSA-N |
| XLogP | 15.21 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 75 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 972.16 |
| LogP ≤ 5 | 15.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|