C61H49N5O3 — CID 161288040
1-N,3-N-bis[4-(4-phenyl-2-pyridinyl)phenyl]-5-[2-[4-(4-phenyl-2-pyridinyl)phenyl]acetyl]cyclohexane-1,3-dicarboxamide (PubChem CID 161288040) has the molecular formula C61H49N5O3 and a molecular weight of 900.10 g/mol. Its IUPAC name is 1-N,3-N-bis[4-(4-phenyl-2-pyridinyl)phenyl]-5-[2-[4-(4-phenyl-2-pyridinyl)phenyl]acetyl]cyclohexane-1,3-dicarboxamide.
| Compound Name | 1-N,3-N-bis[4-(4-phenyl-2-pyridinyl)phenyl]-5-[2-[4-(4-phenyl-2-pyridinyl)phenyl]acetyl]cyclohexane-1,3-dicarboxamide |
|---|---|
| PubChem CID | 161288040 |
| Molecular Formula | C61H49N5O3 |
| Molecular Weight | 900.10 g/mol |
| Exact Mass | 899.38 |
| IUPAC Name | 1-N,3-N-bis[4-(4-phenyl-2-pyridinyl)phenyl]-5-[2-[4-(4-phenyl-2-pyridinyl)phenyl]acetyl]cyclohexane-1,3-dicarboxamide |
| SMILES | O=C(Cc1ccc(-c2cc(-c3ccccc3)ccn2)cc1)C1CC(C(=O)Nc2ccc(-c3cc(-c4ccccc4)ccn3)cc2)CC(C(=O)Nc2ccc(-c3cc(-c4ccccc4)ccn3)cc2)C1 |
| InChI | InChI=1S/C61H49N5O3/c67-59(34-41-16-18-45(19-17-41)56-38-48(28-31-62-56)42-10-4-1-5-11-42)51-35-52(60(68)65-54-24-20-46(21-25-54)57-39-49(29-32-63-57)43-12-6-2-7-13-43)37-53(36-51)61(69)66-55-26-22-47(23-27-55)58-40-50(30-33-64-58)44-14-8-3-9-15-44/h1-33,38-40,51-53H,34-37H2,(H,65,68)(H,66,69) |
| InChIKey | VFZFBMMWQPIXPF-UHFFFAOYSA-N |
| XLogP | 13.30 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 900.10 |
| LogP ≤ 5 | 13.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |