C14H29N — CID 14783193
(E)-9-deuterio-7-(deuteriomethyl)-N,N-diethylnon-2-en-1-amine (PubChem CID 14783193) has the molecular formula C14H29N and a molecular weight of 213.41 g/mol. Its IUPAC name is (E)-9-deuterio-7-(deuteriomethyl)-N,N-diethylnon-2-en-1-amine.
| Compound Name | (E)-9-deuterio-7-(deuteriomethyl)-N,N-diethylnon-2-en-1-amine |
|---|---|
| PubChem CID | 14783193 |
| Molecular Formula | C14H29N |
| Molecular Weight | 213.41 g/mol |
| Exact Mass | 213.24 |
| IUPAC Name | (E)-9-deuterio-7-(deuteriomethyl)-N,N-diethylnon-2-en-1-amine |
| SMILES | [2H]CCC(C[2H])CCC/C=C/CN(CC)CC |
| InChI | InChI=1S/C14H29N/c1-5-14(4)12-10-8-9-11-13-15(6-2)7-3/h9,11,14H,5-8,10,12-13H2,1-4H3/b11-9+/i1D,4D |
| InChIKey | QGUKRKOTFBJALQ-RSLFYTNVSA-N |
| XLogP | 4.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|