C17H20ClNO2 — CID 147831957
(2S)-2-(4-chlorophenyl)-3-(3-methoxyazetidin-1-yl)-1-(2-methylidenecyclopropyl)propan-1-one (PubChem CID 147831957) has the molecular formula C17H20ClNO2 and a molecular weight of 305.80 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenyl)-3-(3-methoxyazetidin-1-yl)-1-(2-methylidenecyclopropyl)propan-1-one.
| Compound Name | (2S)-2-(4-chlorophenyl)-3-(3-methoxyazetidin-1-yl)-1-(2-methylidenecyclopropyl)propan-1-one |
|---|---|
| PubChem CID | 147831957 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (2S)-2-(4-chlorophenyl)-3-(3-methoxyazetidin-1-yl)-1-(2-methylidenecyclopropyl)propan-1-one |
| SMILES | C=C1CC1C(=O)[C@H](CN1CC(OC)C1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H20ClNO2/c1-11-7-15(11)17(20)16(10-19-8-14(9-19)21-2)12-3-5-13(18)6-4-12/h3-6,14-16H,1,7-10H2,2H3/t15?,16-/m1/s1 |
| InChIKey | HRGRJNRHEWMNLY-OEMAIJDKSA-N |
| XLogP | 2.90 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|