C16H23ClN2O — CID 71123868
(3S)-3-(4-chlorophenyl)-4-(4-ethylpiperazin-1-yl)butan-2-one (PubChem CID 71123868) has the molecular formula C16H23ClN2O and a molecular weight of 294.83 g/mol. Its IUPAC name is (3S)-3-(4-chlorophenyl)-4-(4-ethylpiperazin-1-yl)butan-2-one.
| Compound Name | (3S)-3-(4-chlorophenyl)-4-(4-ethylpiperazin-1-yl)butan-2-one |
|---|---|
| PubChem CID | 71123868 |
| Molecular Formula | C16H23ClN2O |
| Molecular Weight | 294.83 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | (3S)-3-(4-chlorophenyl)-4-(4-ethylpiperazin-1-yl)butan-2-one |
| SMILES | CCN1CCN(C[C@@H](C(C)=O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H23ClN2O/c1-3-18-8-10-19(11-9-18)12-16(13(2)20)14-4-6-15(17)7-5-14/h4-7,16H,3,8-12H2,1-2H3/t16-/m0/s1 |
| InChIKey | IZANMKDYPUKRMM-INIZCTEOSA-N |
| XLogP | 2.65 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.83 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |