C17H25ClN2O — CID 77427140
3-(4-chlorophenyl)-4-(4-propan-2-ylpiperazin-1-yl)butan-2-one (PubChem CID 77427140) has the molecular formula C17H25ClN2O and a molecular weight of 308.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(4-propan-2-ylpiperazin-1-yl)butan-2-one.
| Compound Name | 3-(4-chlorophenyl)-4-(4-propan-2-ylpiperazin-1-yl)butan-2-one |
|---|---|
| PubChem CID | 77427140 |
| Molecular Formula | C17H25ClN2O |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(4-propan-2-ylpiperazin-1-yl)butan-2-one |
| SMILES | CC(=O)C(CN1CCN(C(C)C)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H25ClN2O/c1-13(2)20-10-8-19(9-11-20)12-17(14(3)21)15-4-6-16(18)7-5-15/h4-7,13,17H,8-12H2,1-3H3 |
| InChIKey | IRFYQZDQRJHFLY-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |