C17H24ClF2NO — CID 143606919
3-(4-chlorophenyl)-4-(4,4-difluoropiperidin-1-yl)butan-2-one;ethane (PubChem CID 143606919) has the molecular formula C17H24ClF2NO and a molecular weight of 331.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(4,4-difluoropiperidin-1-yl)butan-2-one;ethane.
| Compound Name | 3-(4-chlorophenyl)-4-(4,4-difluoropiperidin-1-yl)butan-2-one;ethane |
|---|---|
| PubChem CID | 143606919 |
| Molecular Formula | C17H24ClF2NO |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(4,4-difluoropiperidin-1-yl)butan-2-one;ethane |
| SMILES | CC.CC(=O)C(CN1CCC(F)(F)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H18ClF2NO.C2H6/c1-11(20)14(12-2-4-13(16)5-3-12)10-19-8-6-15(17,18)7-9-19;1-2/h2-5,14H,6-10H2,1H3;1-2H3 |
| InChIKey | AQXWLRKPWGZLLH-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |