C17H21ClF2O — CID 162564099
2-(4-chlorophenyl)-1-(4,4-difluorocyclohexyl)pentan-3-one (PubChem CID 162564099) has the molecular formula C17H21ClF2O and a molecular weight of 314.80 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-1-(4,4-difluorocyclohexyl)pentan-3-one.
| Compound Name | 2-(4-chlorophenyl)-1-(4,4-difluorocyclohexyl)pentan-3-one |
|---|---|
| PubChem CID | 162564099 |
| Molecular Formula | C17H21ClF2O |
| Molecular Weight | 314.80 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 2-(4-chlorophenyl)-1-(4,4-difluorocyclohexyl)pentan-3-one |
| SMILES | CCC(=O)C(CC1CCC(F)(F)CC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H21ClF2O/c1-2-16(21)15(13-3-5-14(18)6-4-13)11-12-7-9-17(19,20)10-8-12/h3-6,12,15H,2,7-11H2,1H3 |
| InChIKey | PCPWWYXMFPNGPT-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.80 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |