C13H13ClF2O2 — CID 58288424
2-(4-chlorophenyl)-2-(2,2-difluorocyclopentyl)acetic acid (PubChem CID 58288424) has the molecular formula C13H13ClF2O2 and a molecular weight of 274.69 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(2,2-difluorocyclopentyl)acetic acid.
| Compound Name | 2-(4-chlorophenyl)-2-(2,2-difluorocyclopentyl)acetic acid |
|---|---|
| PubChem CID | 58288424 |
| Molecular Formula | C13H13ClF2O2 |
| Molecular Weight | 274.69 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(2,2-difluorocyclopentyl)acetic acid |
| SMILES | O=C(O)C(c1ccc(Cl)cc1)C1CCCC1(F)F |
| InChI | InChI=1S/C13H13ClF2O2/c14-9-5-3-8(4-6-9)11(12(17)18)10-2-1-7-13(10,15)16/h3-6,10-11H,1-2,7H2,(H,17,18) |
| InChIKey | WCIBQDBUTXADDK-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |