C27H28ClF3INO3 — CID 118102571
2-iodopropan-2-yl 1-[[3-[[2-(4-chlorophenyl)-2-(2,2-difluorocyclopentyl)acetyl]amino]-4-fluorophenyl]methyl]cyclopropane-1-carboxylate (PubChem CID 118102571) has the molecular formula C27H28ClF3INO3 and a molecular weight of 633.88 g/mol. Its IUPAC name is 2-iodopropan-2-yl 1-[[3-[[2-(4-chlorophenyl)-2-(2,2-difluorocyclopentyl)acetyl]amino]-4-fluorophenyl]methyl]cyclopropane-1-carboxylate.
| Compound Name | 2-iodopropan-2-yl 1-[[3-[[2-(4-chlorophenyl)-2-(2,2-difluorocyclopentyl)acetyl]amino]-4-fluorophenyl]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 118102571 |
| Molecular Formula | C27H28ClF3INO3 |
| Molecular Weight | 633.88 g/mol |
| Exact Mass | 633.08 |
| IUPAC Name | 2-iodopropan-2-yl 1-[[3-[[2-(4-chlorophenyl)-2-(2,2-difluorocyclopentyl)acetyl]amino]-4-fluorophenyl]methyl]cyclopropane-1-carboxylate |
| SMILES | CC(C)(I)OC(=O)C1(Cc2ccc(F)c(NC(=O)C(c3ccc(Cl)cc3)C3CCCC3(F)F)c2)CC1 |
| InChI | InChI=1S/C27H28ClF3INO3/c1-25(2,32)36-24(35)26(12-13-26)15-16-5-10-20(29)21(14-16)33-23(34)22(17-6-8-18(28)9-7-17)19-4-3-11-27(19,30)31/h5-10,14,19,22H,3-4,11-13,15H2,1-2H3,(H,33,34) |
| InChIKey | VYFVAPIXGFNANJ-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.88 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|