C22H22ClF4NO3 — CID 163501229
1-[[3-[[(2S,3R)-2-(4-chlorocyclohexa-1,5-dien-1-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]-4-fluorophenyl]methyl]cyclopropane-1-carboxylic acid (PubChem CID 163501229) has the molecular formula C22H22ClF4NO3 and a molecular weight of 459.87 g/mol. Its IUPAC name is 1-[[3-[[(2S,3R)-2-(4-chlorocyclohexa-1,5-dien-1-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]-4-fluorophenyl]methyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[[3-[[(2S,3R)-2-(4-chlorocyclohexa-1,5-dien-1-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]-4-fluorophenyl]methyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 163501229 |
| Molecular Formula | C22H22ClF4NO3 |
| Molecular Weight | 459.87 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | 1-[[3-[[(2S,3R)-2-(4-chlorocyclohexa-1,5-dien-1-yl)-4,4,4-trifluoro-3-methylbutanoyl]amino]-4-fluorophenyl]methyl]cyclopropane-1-carboxylic acid |
| SMILES | C[C@H]([C@H](C(=O)Nc1cc(CC2(C(=O)O)CC2)ccc1F)C1=CCC(Cl)C=C1)C(F)(F)F |
| InChI | InChI=1S/C22H22ClF4NO3/c1-12(22(25,26)27)18(14-3-5-15(23)6-4-14)19(29)28-17-10-13(2-7-16(17)24)11-21(8-9-21)20(30)31/h2-5,7,10,12,15,18H,6,8-9,11H2,1H3,(H,28,29)(H,30,31)/t12-,15?,18+/m1/s1 |
| InChIKey | CUXJGWKQIYRCAX-YOAWFHMFSA-N |
| XLogP | 5.48 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.87 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|