C18H24ClNO3 — CID 111112247
[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(1-hydroxycyclopentyl)methanone (PubChem CID 111112247) has the molecular formula C18H24ClNO3 and a molecular weight of 337.85 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(1-hydroxycyclopentyl)methanone.
| Compound Name | [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(1-hydroxycyclopentyl)methanone |
|---|---|
| PubChem CID | 111112247 |
| Molecular Formula | C18H24ClNO3 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.14 |
| IUPAC Name | [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(1-hydroxycyclopentyl)methanone |
| SMILES | O=C(N1CCC(C(O)c2ccc(Cl)cc2)CC1)C1(O)CCCC1 |
| InChI | InChI=1S/C18H24ClNO3/c19-15-5-3-13(4-6-15)16(21)14-7-11-20(12-8-14)17(22)18(23)9-1-2-10-18/h3-6,14,16,21,23H,1-2,7-12H2 |
| InChIKey | CLLYNXRXDODTAZ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |