C19H26ClNO2 — CID 111112309
1-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-2-cyclopentylethanone (PubChem CID 111112309) has the molecular formula C19H26ClNO2 and a molecular weight of 335.88 g/mol. Its IUPAC name is 1-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-2-cyclopentylethanone.
| Compound Name | 1-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-2-cyclopentylethanone |
|---|---|
| PubChem CID | 111112309 |
| Molecular Formula | C19H26ClNO2 |
| Molecular Weight | 335.88 g/mol |
| Exact Mass | 335.17 |
| IUPAC Name | 1-[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-2-cyclopentylethanone |
| SMILES | O=C(CC1CCCC1)N1CCC(C(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C19H26ClNO2/c20-17-7-5-15(6-8-17)19(23)16-9-11-21(12-10-16)18(22)13-14-3-1-2-4-14/h5-8,14,16,19,23H,1-4,9-13H2 |
| InChIKey | WDHYTEABHKIRGG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.88 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |