C17H22ClNO2S — CID 111477424
[4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(thiolan-2-yl)methanone (PubChem CID 111477424) has the molecular formula C17H22ClNO2S and a molecular weight of 339.89 g/mol. Its IUPAC name is [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(thiolan-2-yl)methanone.
| Compound Name | [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(thiolan-2-yl)methanone |
|---|---|
| PubChem CID | 111477424 |
| Molecular Formula | C17H22ClNO2S |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | [4-[(4-chlorophenyl)-hydroxymethyl]piperidin-1-yl]-(thiolan-2-yl)methanone |
| SMILES | O=C(C1CCCS1)N1CCC(C(O)c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H22ClNO2S/c18-14-5-3-12(4-6-14)16(20)13-7-9-19(10-8-13)17(21)15-2-1-11-22-15/h3-6,13,15-16,20H,1-2,7-11H2 |
| InChIKey | YXUXWBFRTMXMJS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |