C20H21ClFNO — CID 142798992
2-(4-chlorophenyl)-2-(4-fluoro-4-phenylcyclohexyl)acetamide (PubChem CID 142798992) has the molecular formula C20H21ClFNO and a molecular weight of 345.85 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(4-fluoro-4-phenylcyclohexyl)acetamide.
| Compound Name | 2-(4-chlorophenyl)-2-(4-fluoro-4-phenylcyclohexyl)acetamide |
|---|---|
| PubChem CID | 142798992 |
| Molecular Formula | C20H21ClFNO |
| Molecular Weight | 345.85 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(4-fluoro-4-phenylcyclohexyl)acetamide |
| SMILES | NC(=O)C(c1ccc(Cl)cc1)C1CCC(F)(c2ccccc2)CC1 |
| InChI | InChI=1S/C20H21ClFNO/c21-17-8-6-14(7-9-17)18(19(23)24)15-10-12-20(22,13-11-15)16-4-2-1-3-5-16/h1-9,15,18H,10-13H2,(H2,23,24) |
| InChIKey | HFURNRJBEDMDMI-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.85 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |