C12H14ClNO3 — CID 126599768
[(1S)-2-(4-chlorophenyl)-1-cyclopropyl-2-hydroxyethyl] carbamate (PubChem CID 126599768) has the molecular formula C12H14ClNO3 and a molecular weight of 255.70 g/mol. Its IUPAC name is [(1S)-2-(4-chlorophenyl)-1-cyclopropyl-2-hydroxyethyl] carbamate.
| Compound Name | [(1S)-2-(4-chlorophenyl)-1-cyclopropyl-2-hydroxyethyl] carbamate |
|---|---|
| PubChem CID | 126599768 |
| Molecular Formula | C12H14ClNO3 |
| Molecular Weight | 255.70 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | [(1S)-2-(4-chlorophenyl)-1-cyclopropyl-2-hydroxyethyl] carbamate |
| SMILES | NC(=O)O[C@@H](C1CC1)C(O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H14ClNO3/c13-9-5-3-7(4-6-9)10(15)11(8-1-2-8)17-12(14)16/h3-6,8,10-11,15H,1-2H2,(H2,14,16)/t10?,11-/m0/s1 |
| InChIKey | UKAKGVROMQJLPR-DTIOYNMSSA-N |
| XLogP | 2.25 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.70 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |