C13H15ClF2N2 — CID 150500954
2-(4-chlorophenyl)-2-(3,3-difluorocyclopentyl)ethanimidamide (PubChem CID 150500954) has the molecular formula C13H15ClF2N2 and a molecular weight of 272.73 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(3,3-difluorocyclopentyl)ethanimidamide.
| Compound Name | 2-(4-chlorophenyl)-2-(3,3-difluorocyclopentyl)ethanimidamide |
|---|---|
| PubChem CID | 150500954 |
| Molecular Formula | C13H15ClF2N2 |
| Molecular Weight | 272.73 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(3,3-difluorocyclopentyl)ethanimidamide |
| SMILES | [H]/N=C(\N)C(c1ccc(Cl)cc1)C1CCC(F)(F)C1 |
| InChI | InChI=1S/C13H15ClF2N2/c14-10-3-1-8(2-4-10)11(12(17)18)9-5-6-13(15,16)7-9/h1-4,9,11H,5-7H2,(H3,17,18) |
| InChIKey | HXUQUIWALDLDIG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.73 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|