C20H22ClF2N5O — CID 167286794
N-(6-chloro-2-pyridinyl)-2-(3,3-difluorocyclopentyl)-2-[4-[(Z)-N'-(methylamino)carbamimidoyl]phenyl]acetamide (PubChem CID 167286794) has the molecular formula C20H22ClF2N5O and a molecular weight of 421.88 g/mol. Its IUPAC name is N-(6-chloro-2-pyridinyl)-2-(3,3-difluorocyclopentyl)-2-[4-[(Z)-N'-(methylamino)carbamimidoyl]phenyl]acetamide.
| Compound Name | N-(6-chloro-2-pyridinyl)-2-(3,3-difluorocyclopentyl)-2-[4-[(Z)-N'-(methylamino)carbamimidoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 167286794 |
| Molecular Formula | C20H22ClF2N5O |
| Molecular Weight | 421.88 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | N-(6-chloro-2-pyridinyl)-2-(3,3-difluorocyclopentyl)-2-[4-[(Z)-N'-(methylamino)carbamimidoyl]phenyl]acetamide |
| SMILES | CN/N=C(\N)c1ccc(C(C(=O)Nc2cccc(Cl)n2)C2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C20H22ClF2N5O/c1-25-28-18(24)13-7-5-12(6-8-13)17(14-9-10-20(22,23)11-14)19(29)27-16-4-2-3-15(21)26-16/h2-8,14,17,25H,9-11H2,1H3,(H2,24,28)(H,26,27,29) |
| InChIKey | AARVLAUJOCGYDS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.88 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|