C18H21ClF2N6OS — CID 167286893
2-[4-[[amino-[(Z)-aminomethylideneamino]amino]methyl]phenyl]-N-(5-chloro-1,3-thiazol-2-yl)-2-(3,3-difluorocyclopentyl)acetamide (PubChem CID 167286893) has the molecular formula C18H21ClF2N6OS and a molecular weight of 442.92 g/mol. Its IUPAC name is 2-[4-[[amino-[(Z)-aminomethylideneamino]amino]methyl]phenyl]-N-(5-chloro-1,3-thiazol-2-yl)-2-(3,3-difluorocyclopentyl)acetamide.
| Compound Name | 2-[4-[[amino-[(Z)-aminomethylideneamino]amino]methyl]phenyl]-N-(5-chloro-1,3-thiazol-2-yl)-2-(3,3-difluorocyclopentyl)acetamide |
|---|---|
| PubChem CID | 167286893 |
| Molecular Formula | C18H21ClF2N6OS |
| Molecular Weight | 442.92 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[4-[[amino-[(Z)-aminomethylideneamino]amino]methyl]phenyl]-N-(5-chloro-1,3-thiazol-2-yl)-2-(3,3-difluorocyclopentyl)acetamide |
| SMILES | N/C=N\N(N)Cc1ccc(C(C(=O)Nc2ncc(Cl)s2)C2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C18H21ClF2N6OS/c19-14-8-24-17(29-14)26-16(28)15(13-5-6-18(20,21)7-13)12-3-1-11(2-4-12)9-27(23)25-10-22/h1-4,8,10,13,15H,5-7,9,23H2,(H2,22,25)(H,24,26,28) |
| InChIKey | WBXLVMYWYVWTBR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 109.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.92 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|