C21H24F3N5O — CID 167286842
2-[4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]phenyl]-2-(3,3-difluorocyclopentyl)-N-(3-fluorophenyl)acetamide (PubChem CID 167286842) has the molecular formula C21H24F3N5O and a molecular weight of 419.45 g/mol. Its IUPAC name is 2-[4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]phenyl]-2-(3,3-difluorocyclopentyl)-N-(3-fluorophenyl)acetamide.
| Compound Name | 2-[4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]phenyl]-2-(3,3-difluorocyclopentyl)-N-(3-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 167286842 |
| Molecular Formula | C21H24F3N5O |
| Molecular Weight | 419.45 g/mol |
| Exact Mass | 419.19 |
| IUPAC Name | 2-[4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]phenyl]-2-(3,3-difluorocyclopentyl)-N-(3-fluorophenyl)acetamide |
| SMILES | CN(N)/N=C(\N)c1ccc(C(C(=O)Nc2cccc(F)c2)C2CCC(F)(F)C2)cc1 |
| InChI | InChI=1S/C21H24F3N5O/c1-29(26)28-19(25)14-7-5-13(6-8-14)18(15-9-10-21(23,24)12-15)20(30)27-17-4-2-3-16(22)11-17/h2-8,11,15,18H,9-10,12,26H2,1H3,(H2,25,28)(H,27,30) |
| InChIKey | DAIPRYOECYNETI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.45 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|