C19H24F2N6O2 — CID 167286862
2-[4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]phenyl]-2-(3,3-difluorocyclopentyl)-N-(3-methyl-1,2-oxazol-5-yl)acetamide (PubChem CID 167286862) has the molecular formula C19H24F2N6O2 and a molecular weight of 406.44 g/mol. Its IUPAC name is 2-[4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]phenyl]-2-(3,3-difluorocyclopentyl)-N-(3-methyl-1,2-oxazol-5-yl)acetamide.
| Compound Name | 2-[4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]phenyl]-2-(3,3-difluorocyclopentyl)-N-(3-methyl-1,2-oxazol-5-yl)acetamide |
|---|---|
| PubChem CID | 167286862 |
| Molecular Formula | C19H24F2N6O2 |
| Molecular Weight | 406.44 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | 2-[4-[(Z)-N'-[amino(methyl)amino]carbamimidoyl]phenyl]-2-(3,3-difluorocyclopentyl)-N-(3-methyl-1,2-oxazol-5-yl)acetamide |
| SMILES | Cc1cc(NC(=O)C(c2ccc(/C(N)=N/N(C)N)cc2)C2CCC(F)(F)C2)on1 |
| InChI | InChI=1S/C19H24F2N6O2/c1-11-9-15(29-26-11)24-18(28)16(14-7-8-19(20,21)10-14)12-3-5-13(6-4-12)17(22)25-27(2)23/h3-6,9,14,16H,7-8,10,23H2,1-2H3,(H2,22,25)(H,24,28) |
| InChIKey | LHMGQSRINCKAEE-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 122.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.44 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|