C23H23BrN2O4 — CID 147832578
3-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-1-ethoxy-1-quinolin-5-ylpropan-2-one (PubChem CID 147832578) has the molecular formula C23H23BrN2O4 and a molecular weight of 471.35 g/mol. Its IUPAC name is 3-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-1-ethoxy-1-quinolin-5-ylpropan-2-one.
| Compound Name | 3-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-1-ethoxy-1-quinolin-5-ylpropan-2-one |
|---|---|
| PubChem CID | 147832578 |
| Molecular Formula | C23H23BrN2O4 |
| Molecular Weight | 471.35 g/mol |
| Exact Mass | 470.08 |
| IUPAC Name | 3-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-1-ethoxy-1-quinolin-5-ylpropan-2-one |
| SMILES | CCOC(C(=O)C/N=C/c1cc(OC)c(Br)c(OC)c1)c1cccc2ncccc12 |
| InChI | InChI=1S/C23H23BrN2O4/c1-4-30-23(17-7-5-9-18-16(17)8-6-10-26-18)19(27)14-25-13-15-11-20(28-2)22(24)21(12-15)29-3/h5-13,23H,4,14H2,1-3H3/b25-13+ |
| InChIKey | HRJSRRKSSKUEAU-DHRITJCHSA-N |
| XLogP | 4.78 |
| TPSA | 70.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.35 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|