C21H23BrN2O6 — CID 72537608
N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-ethoxyacetamide (PubChem CID 72537608) has the molecular formula C21H23BrN2O6 and a molecular weight of 479.33 g/mol. Its IUPAC name is N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-ethoxyacetamide.
| Compound Name | N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-ethoxyacetamide |
|---|---|
| PubChem CID | 72537608 |
| Molecular Formula | C21H23BrN2O6 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-(2,3-dihydro-1,4-benzodioxin-5-yl)-2-ethoxyacetamide |
| SMILES | CCOC(C(=O)NN=Cc1cc(OC)c(Br)c(OC)c1)c1cccc2c1OCCO2 |
| InChI | InChI=1S/C21H23BrN2O6/c1-4-28-20(14-6-5-7-15-19(14)30-9-8-29-15)21(25)24-23-12-13-10-16(26-2)18(22)17(11-13)27-3/h5-7,10-12,20H,4,8-9H2,1-3H3,(H,24,25) |
| InChIKey | ULVNVLDBHFHUEP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|