C22H26BrN3O5 — CID 72537620
N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-ethoxy-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide (PubChem CID 72537620) has the molecular formula C22H26BrN3O5 and a molecular weight of 492.37 g/mol. Its IUPAC name is N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-ethoxy-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide.
| Compound Name | N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-ethoxy-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide |
|---|---|
| PubChem CID | 72537620 |
| Molecular Formula | C22H26BrN3O5 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-ethoxy-2-(4-methyl-2,3-dihydro-1,4-benzoxazin-7-yl)acetamide |
| SMILES | CCOC(C(=O)NN=Cc1cc(OC)c(Br)c(OC)c1)c1ccc2c(c1)OCCN2C |
| InChI | InChI=1S/C22H26BrN3O5/c1-5-30-21(15-6-7-16-17(12-15)31-9-8-26(16)2)22(27)25-24-13-14-10-18(28-3)20(23)19(11-14)29-4/h6-7,10-13,21H,5,8-9H2,1-4H3,(H,25,27) |
| InChIKey | QYIPTQINHSQNMB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 81.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|