C22H26BrN3O6S — CID 72537601
N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-methoxyacetamide (PubChem CID 72537601) has the molecular formula C22H26BrN3O6S and a molecular weight of 540.44 g/mol. Its IUPAC name is N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-methoxyacetamide.
| Compound Name | N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 72537601 |
| Molecular Formula | C22H26BrN3O6S |
| Molecular Weight | 540.44 g/mol |
| Exact Mass | 539.07 |
| IUPAC Name | N-[(4-bromo-3,5-dimethoxyphenyl)methylideneamino]-2-[4-(1,1-dioxo-1,4-thiazinan-4-yl)phenyl]-2-methoxyacetamide |
| SMILES | COc1cc(C=NNC(=O)C(OC)c2ccc(N3CCS(=O)(=O)CC3)cc2)cc(OC)c1Br |
| InChI | InChI=1S/C22H26BrN3O6S/c1-30-18-12-15(13-19(31-2)20(18)23)14-24-25-22(27)21(32-3)16-4-6-17(7-5-16)26-8-10-33(28,29)11-9-26/h4-7,12-14,21H,8-11H2,1-3H3,(H,25,27) |
| InChIKey | YLDZXUUFBPSDJR-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|